| Name | 3-Amino-4-hydroxybiphenyl 2-Amino-4-phenylphenol |
| Synonyms | 214-484-8 3-AMINOBIPHENYL-4-OL 3-aminobiphenyl-4-ol 2-Amino-4-phenylphenol LABOTEST-BB LT00089250 2-AMino-4-phenylphenol 3-AMINO-4-PHENYLPHENOL 3-AMINO-4-HYDROXYBIPHENYL 3-Amino-4-hydroxybiphenyl 1'-biphenyl]-4-ol,3-amino-[ 1'-biphenyl)-4-ol,3-amino-( [1,1'-biphenyl]-4-ol, 3-amino- |
| CAS | 1134-36-7 |
| EINECS | 214-484-8 |
| InChI | InChI=1/C12H11NO/c13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9/h1-8,14H,13H2 |
| InChIKey | IGIDZGNPFWGICD-UHFFFAOYSA-N |
| Molecular Formula | C12H11NO |
| Molar Mass | 185.22 |
| Density | 1.191±0.06 g/cm3(Predicted) |
| Melting Point | 198-202 °C (lit.) |
| Boling Point | 356.0±35.0 °C(Predicted) |
| Flash Point | 169.1°C |
| Vapor Presure | 1.46E-05mmHg at 25°C |
| Appearance | Powder |
| Color | White to light brown |
| pKa | 9.66±0.18(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.653 |
| MDL | MFCD00059187 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 2 |
| RTECS | DV6037500 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |